ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-98-3 1,3-diethyl-1,3-diphenylurea |
|
| Naam product | 1,3-diethyl-1,3-diphenylurea |
| Engelse naam | 1,3-diethyl-1,3-diphenylurea;N,N-Diethyl-N,N-diphenylurea;CENTRALITE I;Ethyl Centralite;1,1-diethyl-3,3-diphenylurea |
| MF | C17H20N2O |
| Molecuulgewicht | 268.3535 |
| InChI | InChI=1/C17H20N2O/c1-3-18(4-2)17(20)19(15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3 |
| CAS-nummer | 85-98-3 |
| EINECS | 201-645-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.097g/cm3 |
| Smeltpunt | 73-75℃ |
| Kookpunt | 375.5°C at 760 mmHg |
| Brekingsindex | 1.591 |
| Vlampunt | 148.5°C |
| Oplosbaarheid in water | Insoluble watery, soluble in most organic solvents. |
| Dampdruk | 7.74E-06mmHg at 25°C |
| Veiligheid Omschrijving | S22||S24/25:; |
| MSDS | |