ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-94-2 1-hydroxyisoquinolin-3(2H)-one |
|
| Naam product | 1-hydroxyisoquinolin-3(2H)-one |
| Engelse naam | 1-hydroxyisoquinolin-3(2H)-one; |
| MF | C9H7NO2 |
| Molecuulgewicht | 161.1574 |
| InChI | InChI=1/C9H7NO2/c11-8-5-6-3-1-2-4-7(6)9(12)10-8/h1-5H,(H2,10,11,12) |
| CAS-nummer | 86-94-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.39g/cm3 |
| Kookpunt | 649.7°C at 760 mmHg |
| Brekingsindex | 1.686 |
| Vlampunt | 346.7°C |
| Dampdruk | 1.26E-19mmHg at 25°C |
| MSDS | |