ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
860197-69-9 4-chloro-6-ethoxy-2-phenyl-quinoline |
|
| Naam product | 4-chloro-6-ethoxy-2-phenyl-quinoline |
| Engelse naam | 4-chloro-6-ethoxy-2-phenyl-quinoline;4-Chloro-6-ethoxy-2-phenylquinoline;quinoline, 4-chloro-6-ethoxy-2-phenyl- |
| MF | C17H14ClNO |
| Molecuulgewicht | 283.75 |
| InChI | InChI=1/C17H14ClNO/c1-2-20-13-8-9-16-14(10-13)15(18)11-17(19-16)12-6-4-3-5-7-12/h3-11H,2H2,1H3 |
| CAS-nummer | 860197-69-9 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.209g/cm3 |
| Kookpunt | 425.6°C at 760 mmHg |
| Brekingsindex | 1.625 |
| Vlampunt | 211.2°C |
| Dampdruk | 4.67E-07mmHg at 25°C |
| MSDS | |