ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
865879-00-1 4-(aminomethyl)-2-fluoranilinehydrochloride |
|
| Naam product | 4-(aminomethyl)-2-fluoranilinehydrochloride |
| Engelse naam | 4-(aminomethyl)-2-fluoroaniline hydrochloride; |
| MF | C7H10ClFN2 |
| Molecuulgewicht | 176.6191 |
| InChI | InChI=1/C7H9FN2.ClH/c8-6-3-5(4-9)1-2-7(6)10;/h1-3H,4,9-10H2;1H |
| CAS-nummer | 865879-00-1 |
| Moleculaire Structuur | ![]() |
| Kookpunt | 243°C at 760 mmHg |
| Vlampunt | 106.1°C |
| Dampdruk | 0.033mmHg at 25°C |
| MSDS | |