ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-01-4 7-dimethylamino-4-methylcoumarin |
|
| Naam product | 7-dimethylamino-4-methylcoumarin |
| Engelse naam | 7-dimethylamino-4-methylcoumarin;7-DIMETHYLAMINO 4-METHYL COUMARIN;7-(dimethylamino)-4-methyl-2H-chromen-2-one |
| MF | C12H13NO2 |
| Molecuulgewicht | 203.2371 |
| InChI | InChI=1/C12H13NO2/c1-8-6-12(14)15-11-7-9(13(2)3)4-5-10(8)11/h4-7H,1-3H3 |
| CAS-nummer | 87-01-4 |
| EINECS | 201-717-3 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.174g/cm3 |
| Kookpunt | 368.9°C at 760 mmHg |
| Brekingsindex | 1.594 |
| Vlampunt | 153.2°C |
| Dampdruk | 1.24E-05mmHg at 25°C |
| MSDS | |