ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-45-6 4-(5-isopropenyl-2-methylcyclopent-1-enyl)butaan-2-on |
|
| Naam product | 4-(5-isopropenyl-2-methylcyclopent-1-enyl)butaan-2-on |
| Synoniemen | 4-(5-isopropenyl-2-methyl-1-cyclopenten-1-yl)-2-butanon; 4-[2-methyl-5-(1-methylethenyl)cyclopent-1-en-1-yl]butaan-2-on; |
| Engelse naam | 4-(5-isopropenyl-2-methylcyclopent-1-enyl)butan-2-one;4-(5-isopropenyl-2-methyl-1-cyclopenten-1-yl)-2-butanone;4-[2-methyl-5-(1-methylethenyl)cyclopent-1-en-1-yl]butan-2-one |
| MF | C13H20O |
| Molecuulgewicht | 192.2973 |
| InChI | InChI=1/C13H20O/c1-9(2)12-7-5-10(3)13(12)8-6-11(4)14/h12H,1,5-8H2,2-4H3 |
| CAS-nummer | 87-45-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 0.91g/cm3 |
| Kookpunt | 270.5°C at 760 mmHg |
| Brekingsindex | 1.473 |
| Vlampunt | 96.9°C |
| Dampdruk | 0.00683mmHg at 25°C |
| MSDS | |