ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-53-6 penicillinezuur |
|
| Naam product | penicillinezuur |
| Synoniemen | ;(2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptaan-2-carbonzuur; |
| Engelse naam | penicillanic acid;(2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| MF | C8H11NO3S |
| Molecuulgewicht | 201.2428 |
| InChI | InChI=1/C8H11NO3S/c1-8(2)6(7(11)12)9-4(10)3-5(9)13-8/h5-6H,3H2,1-2H3,(H,11,12)/t5-,6+/m1/s1 |
| CAS-nummer | 87-53-6 |
| EINECS | 201-750-3 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.46g/cm3 |
| Kookpunt | 423.8°C at 760 mmHg |
| Brekingsindex | 1.624 |
| Vlampunt | 210.1°C |
| Dampdruk | 2.26E-08mmHg at 25°C |
| MSDS | |