ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-62-7 2,6-Dimethylaniline |
|
| Naam product | 2,6-Dimethylaniline |
| Engelse naam | 2,6-Dimethylaniline;2,6-Xylidine;2,6-Dimethylanilin |
| MF | C8H11N |
| Molecuulgewicht | 121.1796 |
| InChI | InChI=1/C8H11N/c1-6-4-3-5-7(2)8(6)9/h3-5H,9H2,1-2H3 |
| CAS-nummer | 87-62-7 |
| EINECS | 201-758-7 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 0.975g/cm3 |
| Smeltpunt | 10-12℃ |
| Kookpunt | 217.9°C at 760 mmHg |
| Brekingsindex | 1.559 |
| Vlampunt | 91.1°C |
| Oplosbaarheid in water | 7.5 g/L (20℃) |
| Dampdruk | 0.13mmHg at 25°C |
| Gevaarsymbolen | |
| Risico-codes | R20/21/22||R37/38||R40||R51/53:; |
| Veiligheid Omschrijving | S23||S25||S36/37||S61:; |
| MSDS | |