ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-63-8 2-Chloro-6-methylaniline |
|
| Naam product | 2-Chloro-6-methylaniline |
| Engelse naam | 2-Chloro-6-methylaniline;6-chloro-o-toluidine;2-Amino-3-chlorotoluene;2-Chloro-6-methyl-phenylamine;2-methyl-6-chloro aniline;2-Chloro-6-Methylaninile |
| MF | C7H8ClN |
| Molecuulgewicht | 141.5981 |
| InChI | InChI=1/C7H8ClN/c1-5-3-2-4-6(8)7(5)9/h2-4H,9H2,1H3 |
| CAS-nummer | 87-63-8 |
| EINECS | 201-759-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.18g/cm3 |
| Smeltpunt | 2℃ |
| Kookpunt | 215°C at 760 mmHg |
| Brekingsindex | 1.585 |
| Vlampunt | 98.9°C |
| Oplosbaarheid in water | Immiscible |
| Dampdruk | 0.151mmHg at 25°C |
| Gevaarsymbolen | |
| Risico-codes | R20/21/22||R36/37/38:; |
| Veiligheid Omschrijving | S26||S36/37/39:; |
| MSDS | |