ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
874590-15-5 4-[(chloroacetyl)amino]-3-methylbenzoic acid |
|
| Naam product | 4-[(chloroacetyl)amino]-3-methylbenzoic acid |
| Engelse naam | 4-[(chloroacetyl)amino]-3-methylbenzoic acid; |
| MF | C10H10ClNO3 |
| Molecuulgewicht | 227.6443 |
| InChI | InChI=1/C10H10ClNO3/c1-6-4-7(10(14)15)2-3-8(6)12-9(13)5-11/h2-4H,5H2,1H3,(H,12,13)(H,14,15) |
| CAS-nummer | 874590-15-5 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.399g/cm3 |
| Kookpunt | 441.185°C at 760 mmHg |
| Brekingsindex | 1.62 |
| Vlampunt | 220.621°C |
| Dampdruk | 0mmHg at 25°C |
| MSDS | |