ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
876491-31-5 4-bromo-6-methoxy-2-phenyl-quinoline |
|
| Naam product | 4-bromo-6-methoxy-2-phenyl-quinoline |
| Engelse naam | 4-bromo-6-methoxy-2-phenyl-quinoline;4-Bromo-6-methoxy-2-phenylquinoline;quinoline, 4-bromo-6-methoxy-2-phenyl- |
| MF | C16H12BrNO |
| Molecuulgewicht | 314.18 |
| InChI | InChI=1/C16H12BrNO/c1-19-12-7-8-15-13(9-12)14(17)10-16(18-15)11-5-3-2-4-6-11/h2-10H,1H3 |
| CAS-nummer | 876491-31-5 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.413g/cm3 |
| Kookpunt | 433°C at 760 mmHg |
| Brekingsindex | 1.65 |
| Vlampunt | 215.7°C |
| Dampdruk | 2.68E-07mmHg at 25°C |
| MSDS | |