ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
879053-84-6 4-(4-methoxy-2,5-dimethylfenyl)-5-methyl-1,3-thiazool-2-amine |
|
| Naam product | 4-(4-methoxy-2,5-dimethylfenyl)-5-methyl-1,3-thiazool-2-amine |
| Engelse naam | 4-(4-methoxy-2,5-dimethylphenyl)-5-methyl-1,3-thiazol-2-amine; |
| MF | C13H16N2OS |
| Molecuulgewicht | 248.3439 |
| InChI | InChI=1/C13H16N2OS/c1-7-6-11(16-4)8(2)5-10(7)12-9(3)17-13(14)15-12/h5-6H,1-4H3,(H2,14,15) |
| CAS-nummer | 879053-84-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.168g/cm3 |
| Kookpunt | 379.8°C at 760 mmHg |
| Brekingsindex | 1.6 |
| Vlampunt | 183.5°C |
| Dampdruk | 5.71E-06mmHg at 25°C |
| MSDS | |