ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-00-6 ethyl-2,4-dichloor-3-oxobutyraat |
|
| Naam product | ethyl-2,4-dichloor-3-oxobutyraat |
| Synoniemen | ethyl-2,4-dichloor-3-oxobutyraat; ethyl-2,4-dichloor-3-oxobutanoaat; |
| Engelse naam | ethyl 2,4-dichloro-3-oxobutyrate;Ethyl 2,4-dichloro-3-oxobutyrate;ethyl 2,4-dichloro-3-oxobutanoate |
| MF | C6H8Cl2O3 |
| Molecuulgewicht | 199.0319 |
| InChI | InChI=1/C6H8Cl2O3/c1-2-11-6(10)5(8)4(9)3-7/h5H,2-3H2,1H3 |
| CAS-nummer | 88-00-6 |
| EINECS | 201-789-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.315g/cm3 |
| Kookpunt | 234.2°C at 760 mmHg |
| Brekingsindex | 1.458 |
| Vlampunt | 95.9°C |
| Dampdruk | 0.0536mmHg at 25°C |
| MSDS | |