ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-87-9 4-chloro-2,6-dinitrophenol |
|
| Naam product | 4-chloro-2,6-dinitrophenol |
| Engelse naam | 4-chloro-2,6-dinitrophenol;Phenol, 4-chloro-2,6-dinitro-;2,6-Dinitro-4-chlorophenol;4-Chloro-2,6-dinitrophenol;AI3-08954;NSC 6212 |
| MF | C6H3ClN2O5 |
| Molecuulgewicht | 218.5514 |
| InChI | InChI=1/C6H3ClN2O5/c7-3-1-4(8(11)12)6(10)5(2-3)9(13)14/h1-2,10H |
| CAS-nummer | 88-87-9 |
| EINECS | 201-863-8 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.769g/cm3 |
| Kookpunt | 252.3°C at 760 mmHg |
| Brekingsindex | 1.669 |
| Vlampunt | 106.4°C |
| Dampdruk | 0.0123mmHg at 25°C |
| MSDS | |