ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
887587-22-6 4-acetoxy-2-amino-5-methoxy-benzoic acid |
|
| Naam product | 4-acetoxy-2-amino-5-methoxy-benzoic acid |
| Engelse naam | 4-acetoxy-2-amino-5-methoxy-benzoic acid;2-Amino-4-acetoxy-5-methoxybenzoic acid;4-(acetyloxy)-2-amino-5-methoxybenzoic acid;4-Acetoxy-2-amino-5-methoxybenzoic acid;benzoic acid, 4-(acetyloxy)-2-amino-5-methoxy- |
| MF | C10H11NO5 |
| Molecuulgewicht | 225.198 |
| InChI | InChI=1/C10H11NO5/c1-5(12)16-9-4-7(11)6(10(13)14)3-8(9)15-2/h3-4H,11H2,1-2H3,(H,13,14) |
| CAS-nummer | 887587-22-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.357g/cm3 |
| Kookpunt | 381.4°C at 760 mmHg |
| Brekingsindex | 1.583 |
| Vlampunt | 184.5°C |
| Dampdruk | 1.69E-06mmHg at 25°C |
| MSDS | |