ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
887922-92-1 4-isocyanato-1-methyl-1H-indool |
|
| Naam product | 4-isocyanato-1-methyl-1H-indool |
| Engelse naam | 4-isocyanato-1-methyl-1H-indole; |
| MF | C10H8N2O |
| Molecuulgewicht | 172.1833 |
| InChI | InChI=1/C10H8N2O/c1-12-6-5-8-9(11-7-13)3-2-4-10(8)12/h2-6H,1H3 |
| CAS-nummer | 887922-92-1 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.16g/cm3 |
| Kookpunt | 297.3°C at 760 mmHg |
| Brekingsindex | 1.606 |
| Vlampunt | 133.6°C |
| Dampdruk | 0.00136mmHg at 25°C |
| MSDS | |