ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-41-8 4-Methoxy-3-nitrobenzoic acid |
|
| Naam product | 4-Methoxy-3-nitrobenzoic acid |
| Engelse naam | 4-Methoxy-3-nitrobenzoic acid;3-Nitro-4-Methoxy Benzoic Acid;3-Nitro-p-anisic acid;4-methoxy-3-nitrobenzoate |
| MF | C8H6NO5 |
| Molecuulgewicht | 196.1375 |
| InChI | InChI=1/C8H7NO5/c1-14-7-3-2-5(8(10)11)4-6(7)9(12)13/h2-4H,1H3,(H,10,11)/p-1 |
| CAS-nummer | 89-41-8 |
| EINECS | 201-906-0 |
| Moleculaire Structuur | ![]() |
| Smeltpunt | 191-194℃ |
| Kookpunt | 371.6°C at 760 mmHg |
| Vlampunt | 178.5°C |
| Dampdruk | 3.52E-06mmHg at 25°C |
| Veiligheid Omschrijving | S24/25:; |
| MSDS | |