ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-62-3 4-Methyl-2-nitroaniline |
|
| Naam product | 4-Methyl-2-nitroaniline |
| Engelse naam | 4-Methyl-2-nitroaniline;C.I. 37110;C.I. Azoic Diazo Component 8;Benzenamine, 4-methyl-2-nitro-;2-Nitro-p-toluidine;4-Amino-3-nitrotoluene;Red Base G;Fast red base GL;2-Nitro-4-methyl aniline;1-Amino-2-nitro-4-methylbenzene;2-nitro-p-toluidin;4-Amino-3-nitrotoluene,CI 37110;4-Methyl-2-nitroamiline;4-methyl-2-nitro-benzenamin;4-methyl-2-nitrobenzenamine;4-methyl-2-nitro-Benzenamine;4-Methyl-6-nitroaniline;C.I.Azoic Diazo Component 8;Fast Red GL base;Red base GL;Red GL base |
| MF | C7H8N2O2 |
| Molecuulgewicht | 152.1506 |
| InChI | InChI=1/C7H8N2O2/c1-5-2-3-6(8)7(4-5)9(10)11/h2-4H,8H2,1H3 |
| CAS-nummer | 89-62-3 |
| EINECS | 201-924-9 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.269g/cm3 |
| Smeltpunt | 112-115℃ |
| Kookpunt | 302.9°C at 760 mmHg |
| Brekingsindex | 1.615 |
| Vlampunt | 137°C |
| Dampdruk | 0.000963mmHg at 25°C |
| Gevaarsymbolen | |
| Risico-codes | R23/24/25||R33||R51/53:; |
| Veiligheid Omschrijving | S28||S36/37||S45||S61:; |
| MSDS | |