ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-65-6 D-Isoascorbic acid |
|
| Naam product | D-Isoascorbic acid |
| Engelse naam | D-Isoascorbic acid;D-Araboascorbic acid;D-erythro-Hex-2-enonic acid, gamma-lactone;Isovitamin C;Erythorbic Acid;(5R)-5-(1,2-dihydroxyethyl)-3,4-dihydroxy-5-methyl-furan-2-one |
| MF | C7H10O6 |
| Molecuulgewicht | 190.1507 |
| InChI | InChI=1/C7H10O6/c1-7(3(9)2-8)5(11)4(10)6(12)13-7/h3,8-11H,2H2,1H3/t3?,7-/m1/s1 |
| CAS-nummer | 89-65-6 |
| EINECS | 201-928-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.751g/cm3 |
| Smeltpunt | 167-172℃ |
| Kookpunt | 502.7°C at 760 mmHg |
| Brekingsindex | 1.655 |
| Vlampunt | 212.9°C |
| Oplosbaarheid in water | 1g/10mL |
| Dampdruk | 3.28E-12mmHg at 25°C |
| Veiligheid Omschrijving | S24/25:; |
| MSDS | |