ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-75-8 2,4-Dichlorobenzoyl chloride |
|
| Naam product | 2,4-Dichlorobenzoyl chloride |
| Engelse naam | 2,4-Dichlorobenzoyl chloride;DCOC;2,4-Dichlorobenzene-1-carbonyl chloride |
| MF | C7H3Cl3O |
| Molecuulgewicht | 209.4571 |
| InChI | InChI=1/C7H3Cl3O/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H |
| CAS-nummer | 89-75-8 |
| EINECS | 201-936-4 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.498g/cm3 |
| Smeltpunt | 21℃ |
| Kookpunt | 251.8°C at 760 mmHg |
| Brekingsindex | 1.576 |
| Vlampunt | 103.4°C |
| Dampdruk | 0.02mmHg at 25°C |
| Gevaarsymbolen | |
| Risico-codes | R34:; |
| Veiligheid Omschrijving | S26||S36/37/39||S45:; |
| MSDS | |