ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
898772-44-6 4-chloor-1-[5-(1,3-dioxol-2-yl)-2-thienyl]butaan-1-on |
|
| Naam product | 4-chloor-1-[5-(1,3-dioxol-2-yl)-2-thienyl]butaan-1-on |
| Engelse naam | 4-chloro-1-[5-(1,3-dioxolan-2-yl)-2-thienyl]butan-1-one; |
| MF | C11H13ClO3S |
| Molecuulgewicht | 260.7371 |
| InChI | InChI=1/C11H13ClO3S/c12-5-1-2-8(13)9-3-4-10(16-9)11-14-6-7-15-11/h3-4,11H,1-2,5-7H2 |
| CAS-nummer | 898772-44-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.301g/cm3 |
| Kookpunt | 430.9°C at 760 mmHg |
| Brekingsindex | 1.551 |
| Vlampunt | 214.4°C |
| Dampdruk | 1.25E-07mmHg at 25°C |
| MSDS | |