ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
898792-27-3 4-(2,3-dimethoxyfenyl)-4-oxo-butaanzuur |
|
| Naam product | 4-(2,3-dimethoxyfenyl)-4-oxo-butaanzuur |
| Engelse naam | 4-(2,3-dimethoxyphenyl)-4-oxo-butanoic acid; |
| MF | C12H14O5 |
| Molecuulgewicht | 238.2366 |
| InChI | InChI=1/C12H14O5/c1-16-10-5-3-4-8(12(10)17-2)9(13)6-7-11(14)15/h3-5H,6-7H2,1-2H3,(H,14,15) |
| CAS-nummer | 898792-27-3 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.211g/cm3 |
| Kookpunt | 406.8°C at 760 mmHg |
| Brekingsindex | 1.527 |
| Vlampunt | 156.2°C |
| Dampdruk | 2.38E-07mmHg at 25°C |
| MSDS | |