ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
959236-69-2 benzyl-3-(3-methoxy-3-oxo-propyl)piperidine-1-carboxylaat |
|
| Naam product | benzyl-3-(3-methoxy-3-oxo-propyl)piperidine-1-carboxylaat |
| Engelse naam | benzyl 3-(3-methoxy-3-oxo-propyl)piperidine-1-carboxylate; |
| MF | C17H23NO4 |
| Molecuulgewicht | 305.3688 |
| InChI | InChI=1/C17H23NO4/c1-21-16(19)10-9-14-8-5-11-18(12-14)17(20)22-13-15-6-3-2-4-7-15/h2-4,6-7,14H,5,8-13H2,1H3 |
| CAS-nummer | 959236-69-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.131g/cm3 |
| Kookpunt | 416.116°C at 760 mmHg |
| Brekingsindex | 1.523 |
| Vlampunt | 205.46°C |
| Dampdruk | 0mmHg at 25°C |
| MSDS | |