ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
175136-64-8 N'-hydroxy-2-piperidinoethanimidamide |
|
produktnavn | N'-hydroxy-2-piperidinoethanimidamide |
Engelsk navn | N'-hydroxy-2-piperidinoethanimidamide;2-piperidinoacetamidoxime;N'-hydroxy-2-piperidin-1-ylethanimidamide |
Molekylær Formel | C7H15N3O |
Molekylvekt | 157.2135 |
InChI | InChI=1/C7H15N3O/c8-7(9-11)6-10-4-2-1-3-5-10/h11H,1-6H2,(H2,8,9) |
CAS-nummer | 175136-64-8 |
Molecular Structure | ![]() |
Tetthet | 1.24g/cm3 |
Smeltepunkt | 161℃ |
Kokepunkt | 302°C at 760 mmHg |
Brytningsindeks | 1.58 |
Flammepunktet | 136.4°C |
Damptrykk | 9.93E-05mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R34##Causes burns.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |