ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
179923-32-1 2,3,4,5-Tetrafluorobenzeneboronic acid |
|
produktnavn | 2,3,4,5-Tetrafluorobenzeneboronic acid |
Engelsk navn | 2,3,4,5-Tetrafluorobenzeneboronic acid;2,3,4,5-Tetrafluorophenylboronic acid |
Molekylær Formel | C6H3BF4O2 |
Molekylvekt | 193.8914 |
InChI | InChI=1/C6H3BF4O2/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1,12-13H |
CAS-nummer | 179923-32-1 |
Molecular Structure | ![]() |
Tetthet | 1.53g/cm3 |
Kokepunkt | 257.6°C at 760 mmHg |
Brytningsindeks | 1.446 |
Flammepunktet | 109.6°C |
Damptrykk | 0.00737mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |