ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
209256-62-2 3,4-Dihydro-2H-1,5-benzodioksepin-6-karbaldehyd |
|
produktnavn | 3,4-Dihydro-2H-1,5-benzodioksepin-6-karbaldehyd |
Engelsk navn | 3,4-Dihydro-2H-1,5-benzodioxepine-6-carbaldehyde; |
Molekylær Formel | C10H10O3 |
Molekylvekt | 178.1846 |
InChI | InChI=1/C10H10O3/c11-7-8-3-1-4-9-10(8)13-6-2-5-12-9/h1,3-4,7H,2,5-6H2 |
CAS-nummer | 209256-62-2 |
Molecular Structure | ![]() |
Tetthet | 1.205g/cm3 |
Smeltepunkt | 74℃ |
Kokepunkt | 299.1°C at 760 mmHg |
Brytningsindeks | 1.568 |
Flammepunktet | 125.5°C |
Damptrykk | 0.00122mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |