ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2150-43-8 Methyl 3,4-dihydroxybenzoate |
|
produktnavn | Methyl 3,4-dihydroxybenzoate |
Engelsk navn | Methyl 3,4-dihydroxybenzoate;3,4-Dihydroxybenzoic acid methyl ester;Methyl protocatechuate |
Molekylær Formel | C8H8O4 |
Molekylvekt | 168.1467 |
InChI | InChI=1/C8H8O4/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,9-10H,1H3 |
CAS-nummer | 2150-43-8 |
Molecular Structure | ![]() |
Tetthet | 1.354g/cm3 |
Kokepunkt | 351.5°C at 760 mmHg |
Brytningsindeks | 1.587 |
Flammepunktet | 148.5°C |
Damptrykk | 2.02E-05mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |