Chemindex > 22739-76-0
NO ▼
22739-76-0 Isopropanol-d8 |
|
| produktnavn | Isopropanol-d8 |
| Engelsk navn | Isopropanol-d8;2-Propanol-d8;IPA-d8;Isopropyl alcohol-d8;propan-2-ol;(~2~H_7_)propan-2-(~2~H)ol |
| Molekylær Formel | C3D8O |
| Molekylvekt | 68.1443 |
| InChI | InChI=1/C3H8O/c1-3(2)4/h3-4H,1-2H3/i1D3,2D3,3D,4D |
| CAS-nummer | 22739-76-0 |
| EINECS | 245-189-2 |
| Molecular Structure |  |
| Tetthet | 0.897g/cm3 |
| Kokepunkt | 73°C at 760 mmHg |
| Brytningsindeks | 1.376 |
| Flammepunktet | 11.7°C |
| Damptrykk | 81.3mmHg at 25°C |
| Hazard symboler |  F##Highly flammable||Xi##Irritant:; |
| Risiko Koder | R11##Highly flammable.||R36##Irritating to eyes.:; |
| Sikkerhet Beskrivelse | S16##Keep away from sources of ignition - No smoking.||S24/25##Avoid contact with skin and eyes.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S7##Keep container tightly closed.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 