ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2688-48-4 2,5-Dihydroxyphenylacetic acid Gamma-lactone |
|
produktnavn | 2,5-Dihydroxyphenylacetic acid Gamma-lactone |
Engelsk navn | 2,5-Dihydroxyphenylacetic acid Gamma-lactone;Homogentisic acid gamma-lactone;5-hydroxybenzofuran-2-one;Homogentisic lactone;5-hydroxy-1-benzofuran-2(3H)-one;Homogentisic acidγ-lactone |
Molekylær Formel | C8H6O3 |
Molekylvekt | 150.1314 |
InChI | InChI=1/C8H6O3/c9-6-1-2-7-5(3-6)4-8(10)11-7/h1-3,9H,4H2 |
CAS-nummer | 2688-48-4 |
EINECS | 220-252-7 |
Molecular Structure | ![]() |
Tetthet | 1.436g/cm3 |
Smeltepunkt | 190-195℃ |
Kokepunkt | 351°C at 760 mmHg |
Brytningsindeks | 1.635 |
Flammepunktet | 167.7°C |
Damptrykk | 2.08E-05mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |