ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306935-52-4 3-klor-5-(2-klorfenyl)isotiazol-4-karboksylsyre |
|
produktnavn | 3-klor-5-(2-klorfenyl)isotiazol-4-karboksylsyre |
Engelsk navn | 3-chloro-5-(2-chlorophenyl)isothiazole-4-carboxylic acid; |
Molekylær Formel | C10H5Cl2NO2S |
Molekylvekt | 274.1232 |
InChI | InChI=1/C10H5Cl2NO2S/c11-6-4-2-1-3-5(6)8-7(10(14)15)9(12)13-16-8/h1-4H,(H,14,15) |
CAS-nummer | 306935-52-4 |
Molecular Structure | ![]() |
Tetthet | 1.576g/cm3 |
Smeltepunkt | 144℃ |
Kokepunkt | 298.2°C at 760 mmHg |
Brytningsindeks | 1.658 |
Flammepunktet | 134.1°C |
Damptrykk | 0.000578mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |