ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
349550-81-8 2,3-dihydro-1,4-benzodioksin-5-karboksamid |
|
produktnavn | 2,3-dihydro-1,4-benzodioksin-5-karboksamid |
Engelsk navn | 2,3-dihydro-1,4-benzodioxine-5-carboxamide; |
Molekylær Formel | C9H9NO3 |
Molekylvekt | 179.1727 |
InChI | InChI=1/C9H9NO3/c10-9(11)6-2-1-3-7-8(6)13-5-4-12-7/h1-3H,4-5H2,(H2,10,11) |
CAS-nummer | 349550-81-8 |
Molecular Structure | ![]() |
Tetthet | 1.307g/cm3 |
Smeltepunkt | 130℃ |
Kokepunkt | 290.1°C at 760 mmHg |
Brytningsindeks | 1.585 |
Flammepunktet | 147.5°C |
Damptrykk | 0.00211mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |