ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
423768-37-0 1-phenyl-1H-pyrazole-5-carbonyl chloride |
|
produktnavn | 1-phenyl-1H-pyrazole-5-carbonyl chloride |
Engelsk navn | 1-phenyl-1H-pyrazole-5-carbonyl chloride; |
Molekylær Formel | C10H7ClN2O |
Molekylvekt | 206.6284 |
InChI | InChI=1/C10H7ClN2O/c11-10(14)9-6-7-12-13(9)8-4-2-1-3-5-8/h1-7H |
CAS-nummer | 423768-37-0 |
Molecular Structure | ![]() |
Tetthet | 1.3g/cm3 |
Smeltepunkt | 53℃ |
Kokepunkt | 320.4°C at 760 mmHg |
Brytningsindeks | 1.623 |
Flammepunktet | 147.6°C |
Damptrykk | 0.000319mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R34##Causes burns.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |