ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
446-22-0 2'-fluoropropiophenone |
|
| produktnavn | 2'-fluoropropiophenone |
| Engelsk navn | 2'-fluoropropiophenone;2'-fluoro-1-phenylpropan-1-one;1-(2'-fluorophenyl)propan-1-one;2-Fluoropropiophenone |
| Molekylær Formel | C9H9FO |
| Molekylvekt | 152.1656 |
| InChI | InChI=1/C9H9FO/c1-2-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
| CAS-nummer | 446-22-0 |
| EINECS | 244-220-7 |
| Molecular Structure | ![]() |
| Tetthet | 1.074g/cm3 |
| Kokepunkt | 204.119°C at 760 mmHg |
| Brytningsindeks | 1.489 |
| Flammepunktet | 77.067°C |
| Damptrykk | 0.268mmHg at 25°C |
| Risiko Koder | R36/38##Irritating to eyes and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |