ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
488-81-3 Adonitol |
|
produktnavn | Adonitol |
Engelsk navn | Adonitol;Ribitol;Ribit = Ribitol = Adonitol;pentitol;D-ribitol;(2S,4R)-pentane-1,2,3,4,5-pentol |
Molekylær Formel | C5H12O5 |
Molekylvekt | 152.1458 |
InChI | InChI=1/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5? |
CAS-nummer | 488-81-3 |
EINECS | 207-685-7 |
Molecular Structure | ![]() |
Tetthet | 1.525g/cm3 |
Smeltepunkt | 101-104℃ |
Kokepunkt | 494.5°C at 760 mmHg |
Brytningsindeks | 1.57 |
Flammepunktet | 261.9°C |
Damptrykk | 7.47E-12mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |