ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50262-50-5 4-formylfenylpentanoat |
|
| produktnavn | 4-formylfenylpentanoat |
| Synonymer | ; 4-Formylfenylvalerat; pentansyre, 4-formylfenylester; |
| Engelsk navn | 4-formylphenyl pentanoate;4-Formylphenyl valerate;pentanoic acid, 4-formylphenyl ester |
| Molekylær Formel | C12H14O3 |
| Molekylvekt | 206.2378 |
| InChI | InChI=1/C12H14O3/c1-2-3-4-12(14)15-11-7-5-10(9-13)6-8-11/h5-9H,2-4H2,1H3 |
| CAS-nummer | 50262-50-5 |
| Molecular Structure | ![]() |
| Tetthet | 1.095g/cm3 |
| Kokepunkt | 319.4°C at 760 mmHg |
| Brytningsindeks | 1.531 |
| Flammepunktet | 139.4°C |
| Damptrykk | 0.00034mmHg at 25°C |
| MSDS | |