ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50262-57-2 4-formylfenylpentylkarbonat |
|
| produktnavn | 4-formylfenylpentylkarbonat |
| Synonymer | ; 4-Formylfenylpentylkarbonat; karbonsyre, 4-formylfenylpentylester; |
| Engelsk navn | 4-formylphenyl pentyl carbonate;4-Formylphenyl pentyl carbonate;carbonic acid, 4-formylphenyl pentyl ester |
| Molekylær Formel | C13H16O4 |
| Molekylvekt | 236.2637 |
| InChI | InChI=1/C13H16O4/c1-2-3-4-9-16-13(15)17-12-7-5-11(10-14)6-8-12/h5-8,10H,2-4,9H2,1H3 |
| CAS-nummer | 50262-57-2 |
| Molecular Structure | ![]() |
| Tetthet | 1.119g/cm3 |
| Kokepunkt | 355.5°C at 760 mmHg |
| Brytningsindeks | 1.524 |
| Flammepunktet | 156.3°C |
| Damptrykk | 3.12E-05mmHg at 25°C |
| MSDS | |