ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51037-47-9 4'-fluor-2-hydroksy-4-(4-fenylpiperazin-1-yl)butyrofenon |
|
| produktnavn | 4'-fluor-2-hydroksy-4-(4-fenylpiperazin-1-yl)butyrofenon |
| Synonymer | Butyrofenon, 4'-fluor-2-hydroksy-4-(4-fenyl-1-piperazinyl)-; 1-(4-fluorfenyl)-2-hydroksy-4-(4-fenyl-1-piperazinyl)-1-butanon; 4'-fluor-2-hydroksy-4-(4-fenyl-1-piperazinyl)butyrofenon; BRN 0843253; 4'-fluor-2-hydroksy-4-(4-fenylpiperazin-1-yl)butyrofenon; 1-(4-fluorfenyl)-2-hydroksy-4-(4-fenylpiperazin-1-yl)butan-1-on; |
| Engelsk navn | 4'-fluoro-2-hydroxy-4-(4-phenylpiperazin-1-yl)butyrophenone;Butyrophenone, 4'-fluoro-2-hydroxy-4-(4-phenyl-1-piperazinyl)-;1-(4-Fluorophenyl)-2-hydroxy-4-(4-phenyl-1-piperazinyl)-1-butanone;4'-Fluoro-2-hydroxy-4-(4-phenyl-1-piperazinyl)butyrophenone;BRN 0843253;4'-Fluoro-2-hydroxy-4-(4-phenylpiperazin-1-yl)butyrophenone;1-(4-fluorophenyl)-2-hydroxy-4-(4-phenylpiperazin-1-yl)butan-1-one |
| Molekylær Formel | C20H23FN2O2 |
| Molekylvekt | 342.4072 |
| InChI | InChI=1/C20H23FN2O2/c21-17-8-6-16(7-9-17)20(25)19(24)10-11-22-12-14-23(15-13-22)18-4-2-1-3-5-18/h1-9,19,24H,10-15H2 |
| CAS-nummer | 51037-47-9 |
| EINECS | 256-929-9 |
| Molecular Structure | ![]() |
| Tetthet | 1.202g/cm3 |
| Kokepunkt | 524.1°C at 760 mmHg |
| Brytningsindeks | 1.582 |
| Flammepunktet | 270.8°C |
| Damptrykk | 8.19E-12mmHg at 25°C |
| MSDS | |