ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52287-51-1 3,4-Ethylenedioxybromobenzene |
|
produktnavn | 3,4-Ethylenedioxybromobenzene |
Engelsk navn | 3,4-Ethylenedioxybromobenzene;3,4-(Ethylenedioxy)bromobenzene;6-Bromo-1,4-benzodioxane;6-Bromo-2,3-dihydro-1,4-benzodioxine |
Molekylær Formel | C8H7BrO2 |
Molekylvekt | 215.044 |
InChI | InChI=1/C8H7BrO2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-2,5H,3-4H2 |
CAS-nummer | 52287-51-1 |
EINECS | 257-817-2 |
Molecular Structure | ![]() |
Tetthet | 1.598g/cm3 |
Kokepunkt | 258.299°C at 760 mmHg |
Brytningsindeks | 1.579 |
Flammepunktet | 117.638°C |
Damptrykk | 0.022mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |