ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53066-87-8 4- ({1-etoksy-2- [4- (etylsulfanyl) fenyl] -2-oksetyl}amino) benzoesyre |
|
| produktnavn | 4- ({1-etoksy-2- [4- (etylsulfanyl) fenyl] -2-oksetyl}amino) benzoesyre |
| Synonymer | ; |
| Engelsk navn | 4-({1-ethoxy-2-[4-(ethylsulfanyl)phenyl]-2-oxoethyl}amino)benzoic acid; |
| Molekylær Formel | C19H21NO4S |
| Molekylvekt | 359.4393 |
| InChI | InChI=1/C19H21NO4S/c1-3-24-18(20-15-9-5-14(6-10-15)19(22)23)17(21)13-7-11-16(12-8-13)25-4-2/h5-12,18,20H,3-4H2,1-2H3,(H,22,23) |
| CAS-nummer | 53066-87-8 |
| Molecular Structure | ![]() |
| Tetthet | 1.26g/cm3 |
| Kokepunkt | 593.6°C at 760 mmHg |
| Brytningsindeks | 1.615 |
| Flammepunktet | 312.8°C |
| Damptrykk | 6.14E-15mmHg at 25°C |
| MSDS | |