ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53242-88-9 4-[(4-chlorophenyl)methyl]phthalazin-1(2H)-one |
|
| produktnavn | 4-[(4-chlorophenyl)methyl]phthalazin-1(2H)-one |
| Engelsk navn | 4-[(4-chlorophenyl)methyl]phthalazin-1(2H)-one;4-((4-Chlorophenyl)methyl)phthalazin-1(2H)-one;4-(4-chlorobenzyl)phthalazin-1(2H)-one |
| Molekylær Formel | C15H11ClN2O |
| Molekylvekt | 270.7136 |
| InChI | InChI=1/C15H11ClN2O/c16-11-7-5-10(6-8-11)9-14-12-3-1-2-4-13(12)15(19)18-17-14/h1-8H,9H2,(H,18,19) |
| CAS-nummer | 53242-88-9 |
| EINECS | 258-445-3 |
| Molecular Structure | ![]() |
| Tetthet | 1.32g/cm3 |
| Kokepunkt | 522.3°C at 760 mmHg |
| Brytningsindeks | 1.66 |
| Flammepunktet | 269.7°C |
| Damptrykk | 1.57E-11mmHg at 25°C |
| MSDS | |