ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54784-12-2 4-heksyloksynaftalen-1-karbaldehyd |
|
| produktnavn | 4-heksyloksynaftalen-1-karbaldehyd |
| Synonymer | 4-heksyloksynaftalen-1-karbaldehyd |
| Engelsk navn | 4-hexyloxynaphthalene-1-carbaldehyde;4-Hexyloxynaphthalene-1-carbaldehyde |
| Molekylær Formel | C17H20O2 |
| Molekylvekt | 256.3395 |
| InChI | InChI=1/C17H20O2/c1-2-3-4-7-12-19-17-11-10-14(13-18)15-8-5-6-9-16(15)17/h5-6,8-11,13H,2-4,7,12H2,1H3 |
| CAS-nummer | 54784-12-2 |
| EINECS | 259-346-8 |
| Molecular Structure | ![]() |
| Tetthet | 1.06g/cm3 |
| Kokepunkt | 413.1°C at 760 mmHg |
| Brytningsindeks | 1.582 |
| Flammepunktet | 180.9°C |
| Damptrykk | 4.94E-07mmHg at 25°C |
| MSDS | |