56051-04-8 1,1-Bis(metylseleno)etan |
| produktnavn |
1,1-Bis(metylseleno)etan |
| Synonymer |
1,1-bis(metylselanyl)etan; |
| Engelsk navn |
1,1-Bis(methylseleno)ethane;1,1-bis(methylselanyl)ethane |
| Molekylær Formel |
C4H10Se2 |
| Molekylvekt |
216.0422 |
| InChI |
InChI=1/C4H10Se2/c1-4(5-2)6-3/h4H,1-3H3 |
| CAS-nummer |
56051-04-8 |
| Molecular Structure |
 |
| Kokepunkt |
198.7°C at 760 mmHg |
| Flammepunktet |
74°C |
| Damptrykk |
0.501mmHg at 25°C |
| Hazard symboler |
 T##Toxic||N##Dangerous for the environment:;
|
| Risiko Koder |
R23/25##Toxic by inhalation and if swallowed.||R33##Danger of cummulative effects.||R50/53##Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:;
|
| Sikkerhet Beskrivelse |
S20/21##When using do not eat, drink or smoke.||S28A##After contact with skin, wash immediately with plenty of water.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S60##This material and its container must be disposed of as hazardous waste.||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:;
|
| MSDS |
Material Safety Data Sheet |
NO ▼
