ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57238-76-3 5-(klormetyl)-3-(4-metoksyfenyl)- 1,2,4-oksadiazol |
|
| produktnavn | 5-(klormetyl)-3-(4-metoksyfenyl)- 1,2,4-oksadiazol |
| Synonymer | 5-(klormetyl)-3-(4-metoksyfenyl)-1,2,4-oksadiazol; |
| Engelsk navn | 5-(Chloromethyl)-3-(4-methoxyphenyl)- 1,2,4-oxadiazole;5-(chloromethyl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole |
| Molekylær Formel | C10H9ClN2O2 |
| Molekylvekt | 224.6437 |
| InChI | InChI=1/C10H9ClN2O2/c1-14-8-4-2-7(3-5-8)10-12-9(6-11)15-13-10/h2-5H,6H2,1H3 |
| CAS-nummer | 57238-76-3 |
| Molecular Structure | ![]() |
| Tetthet | 1.278g/cm3 |
| Smeltepunkt | 51℃ |
| Kokepunkt | 354.9°C at 760 mmHg |
| Brytningsindeks | 1.547 |
| Flammepunktet | 168.4°C |
| Damptrykk | 6.63E-05mmHg at 25°C |
| Hazard symboler | |
| Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |