ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5781-53-3 Methyl oxalyl chloride |
|
produktnavn | Methyl oxalyl chloride |
Engelsk navn | Methyl oxalyl chloride;Methyl chloroglyoxylate;Monomethyl oxalyl chloride;methyl chlorooxoacetate;Chloroglyoxylic acid methyl ester |
Molekylær Formel | C3H3ClO3 |
Molekylvekt | 122.5071 |
InChI | InChI=1/C3H3ClO3/c1-7-3(6)2(4)5/h1H3 |
CAS-nummer | 5781-53-3 |
EINECS | 227-307-4 |
Molecular Structure | ![]() |
Tetthet | 1.36g/cm3 |
Kokepunkt | 119°C at 760 mmHg |
Brytningsindeks | 1.416 |
Flammepunktet | 46.7°C |
Damptrykk | 16.3mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R10##Flammable.||R34##Causes burns.:; |
Sikkerhet Beskrivelse | S16##Keep away from sources of ignition - No smoking.||S28A##After contact with skin, wash immediately with plenty of water.||S9##Keep container in a well-ventilated place.:; |
MSDS |