ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58743-77-4 4'-methoxy[1,1'-biphenyl]-4-carbonitrile |
|
| produktnavn | 4'-methoxy[1,1'-biphenyl]-4-carbonitrile |
| Engelsk navn | 4'-methoxy[1,1'-biphenyl]-4-carbonitrile;(1,1'-Biphenyl)-4-carbonitrile, 4'-methoxy-;4'-Methoxy-(1,1'-biphenyl)-4-carbonitrile;4-Cyano-4'-methoxybiphenyl;BRN 2836376;Methoxycyanodiphenyl;4'-Methoxy(1,1'-biphenyl)-4-carbonitrile;4'-methoxybiphenyl-4-carbonitrile |
| Molekylær Formel | C14H11NO |
| Molekylvekt | 209.2432 |
| InChI | InChI=1/C14H11NO/c1-16-14-8-6-13(7-9-14)12-4-2-11(10-15)3-5-12/h2-9H,1H3 |
| CAS-nummer | 58743-77-4 |
| EINECS | 261-416-8 |
| Molecular Structure | ![]() |
| Tetthet | 1.14g/cm3 |
| Kokepunkt | 368.8°C at 760 mmHg |
| Brytningsindeks | 1.599 |
| Flammepunktet | 155.5°C |
| Damptrykk | 1.24E-05mmHg at 25°C |
| MSDS | |