ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58940-75-3 4-(3-metylbut-2-en-1-yl)cyklopent-4-en-1,3-dion |
|
| produktnavn | 4-(3-metylbut-2-en-1-yl)cyklopent-4-en-1,3-dion |
| Synonymer | ; 4-(3-metyl-2-butenyl)-4-cyklopenten-1,3-dion; 4-cyklopenten-1,3-dion, 4-(3-metyl-2-butenyl)-; |
| Engelsk navn | 4-(3-methylbut-2-en-1-yl)cyclopent-4-ene-1,3-dione;4-(3-Methyl-2-butenyl)-4-cyclopentene-1,3-dione;4-Cyclopentene-1,3-dione, 4-(3-methyl-2-butenyl)- |
| Molekylær Formel | C10H12O2 |
| Molekylvekt | 164.2011 |
| InChI | InChI=1/C10H12O2/c1-7(2)3-4-8-5-9(11)6-10(8)12/h3,5H,4,6H2,1-2H3 |
| CAS-nummer | 58940-75-3 |
| Molecular Structure | ![]() |
| Tetthet | 1.069g/cm3 |
| Kokepunkt | 273.1°C at 760 mmHg |
| Brytningsindeks | 1.511 |
| Flammepunktet | 101.3°C |
| Damptrykk | 0.00586mmHg at 25°C |
| MSDS | |