ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59177-82-1 4-[(4-methylpiperazin-1-yl)methyl]octahydro-1H-2,5-methanoinden-4-ol (2Z)-but-2-enedioate (salt) |
|
| produktnavn | 4-[(4-methylpiperazin-1-yl)methyl]octahydro-1H-2,5-methanoinden-4-ol (2Z)-but-2-enedioate (salt) |
| Engelsk navn | 4-[(4-methylpiperazin-1-yl)methyl]octahydro-1H-2,5-methanoinden-4-ol (2Z)-but-2-enedioate (salt); |
| Molekylær Formel | C20H32N2O5 |
| Molekylvekt | 380.4785 |
| InChI | InChI=1/C16H28N2O.C4H4O4/c1-17-4-6-18(7-5-17)11-16(19)14-3-2-13-8-12(9-14)10-15(13)16;5-3(6)1-2-4(7)8/h12-15,19H,2-11H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| CAS-nummer | 59177-82-1 |
| Molecular Structure | ![]() |
| Kokepunkt | 382.9°C at 760 mmHg |
| Flammepunktet | 176.9°C |
| Damptrykk | 1.94E-07mmHg at 25°C |
| MSDS | |