ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
644-13-3 2'-benzonaphthone |
|
produktnavn | 2'-benzonaphthone |
Engelsk navn | 2'-benzonaphthone;Methanone, 2-naphthalenylphenyl-;2-Benzonaphthone;2-Benzoylnaphthalene;2-Naphthyl phenyl ketone;Ketone, 2-naphthyl phenyl;NSC 5190;beta-Benzoylnaphthalene;2'-Benzonaphthone;naphthalen-2-yl(phenyl)methanone |
Molekylær Formel | C17H12O |
Molekylvekt | 232.2766 |
InChI | InChI=1/C17H12O/c18-17(14-7-2-1-3-8-14)16-11-10-13-6-4-5-9-15(13)12-16/h1-12H |
CAS-nummer | 644-13-3 |
EINECS | 211-410-6 |
Molecular Structure | ![]() |
Tetthet | 1.151g/cm3 |
Smeltepunkt | 76-82℃ |
Kokepunkt | 384.1°C at 760 mmHg |
Brytningsindeks | 1.653 |
Flammepunktet | 174.7°C |
Damptrykk | 4.2E-06mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |