Chemindex > 67969-86-2
NO ▼
67969-86-2 decyldihydrogenfosfat, forbindelse med 2- (dibutylamino)etanol |
|
| produktnavn | decyldihydrogenfosfat, forbindelse med 2- (dibutylamino)etanol |
| Synonymer | Fosforsyre, monodecylester, compd.med 2-(dibutylamino)etanol (1:?); Fosforsyre, monodecylester, dibutyletanolaminsalt; Decyldihydrogenfosfat, forbindelse med 2- (dibutylamino)etanol; Fosforsyre, monodecylester, compd.med 2-(dibutylamino)etanol; decyldihydrogenfosfat - 2- (dibutylamino)etanol (1:1); |
| Engelsk navn | decyl dihydrogen phosphate, compound with 2-(dibutylamino)ethanol;Phosphoric acid, monodecyl ester, compd. with 2-(dibutylamino)ethanol (1:?);Phosphoric acid, monodecyl ester, dibutylethanolamine salt;Decyl dihydrogen phosphate, compound with 2-(dibutylamino)ethanol;Phosphoric acid, monodecyl ester, compd. with 2-(dibutylamino)ethanol;decyl dihydrogen phosphate - 2-(dibutylamino)ethanol (1:1) |
| Molekylær Formel | C20H46NO5P |
| Molekylvekt | 411.5567 |
| InChI | InChI=1/C10H23NO.C10H23O4P/c1-3-5-7-11(9-10-12)8-6-4-2;1-2-3-4-5-6-7-8-9-10-14-15(11,12)13/h12H,3-10H2,1-2H3;2-10H2,1H3,(H2,11,12,13) |
| CAS-nummer | 67969-86-2 |
| EINECS | 267-988-5 |
| Molecular Structure |  |
| Kokepunkt | 357.2°C at 760 mmHg |
| Flammepunktet | 169.8°C |
| Damptrykk | 4.55E-06mmHg at 25°C |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 67969-86-2 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 