ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
702-23-8 4-Methoxyphenethyl alcohol |
|
| produktnavn | 4-Methoxyphenethyl alcohol |
| Engelsk navn | 4-Methoxyphenethyl alcohol;p-Methoxyphenethyl alcohol;2-(4-Methoxyphenyl)ethanol;p-Methoxyphenylethanol |
| Molekylær Formel | C9H12O2 |
| Molekylvekt | 152.1904 |
| InChI | InChI=1/C9H12O2/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5,10H,6-7H2,1H3 |
| CAS-nummer | 702-23-8 |
| EINECS | 211-866-6 |
| Molecular Structure | ![]() |
| Tetthet | 1.058g/cm3 |
| Smeltepunkt | 28℃ |
| Kokepunkt | 257.5°C at 760 mmHg |
| Brytningsindeks | 1.524 |
| Flammepunktet | 110.2°C |
| Damptrykk | 0.00745mmHg at 25°C |
| Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |